CAS 307524-95-4 is the registry number for 2-((3,5-Dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)amino)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide (CAS 307524-95-4) is a chemical compound with the molecular formula C5H7N5O3 and a molecular weight of 185.14 g/mol. IUPAC name: 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide. InChIKey: LXWRRWGYQJALEN-UHFFFAOYSA-N.
| Molecular formula | C5H7N5O3 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide |
| InChIKey | LXWRRWGYQJALEN-UHFFFAOYSA-N |
| SMILES | C(C(=O)N)NC1=NNC(=O)NC1=O |
Computed by PubChem (NCBI)