CAS 376618-71-2 is the registry number for 1–Methyl–4–nitro–1H–pyrazole–3–carbohydrazide. Offered by: GLPBio. Available pack sizes: 100mg.
1-methyl-4-nitropyrazole-3-carbohydrazide (CAS 376618-71-2) is a chemical compound with the molecular formula C5H7N5O3 and a molecular weight of 185.14 g/mol. IUPAC name: 1-methyl-4-nitropyrazole-3-carbohydrazide. InChIKey: FDNHAKFWMLAFFD-UHFFFAOYSA-N.
| Molecular formula | C5H7N5O3 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | 1-methyl-4-nitropyrazole-3-carbohydrazide |
| InChIKey | FDNHAKFWMLAFFD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(=O)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)