CAS 322405-72-1 is the registry number for Icariin Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenylmethoxy-1-(2,4,6-trihydroxyphenyl)ethanone (CAS 322405-72-1) is a chemical compound with the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. IUPAC name: 2-phenylmethoxy-1-(2,4,6-trihydroxyphenyl)ethanone. InChIKey: PHXGLZOIAVVABE-UHFFFAOYSA-N.
| Molecular formula | C15H14O5 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | 2-phenylmethoxy-1-(2,4,6-trihydroxyphenyl)ethanone |
| InChIKey | PHXGLZOIAVVABE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCC(=O)C2=C(C=C(C=C2O)O)O |
Computed by PubChem (NCBI)