CAS 30760-09-9 is the registry number for Methyl-beta-d-thioglucopyranoside, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-methylsulfanyloxane-3,4,5-triol (CAS 30760-09-9) is a chemical compound with the molecular formula C7H14O5S and a molecular weight of 210.25 g/mol. IUPAC name: (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-methylsulfanyloxane-3,4,5-triol. InChIKey: LZFNFLTVAMOOPJ-ZFYZTMLRSA-N.
| Molecular formula | C7H14O5S |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-methylsulfanyloxane-3,4,5-triol |
| InChIKey | LZFNFLTVAMOOPJ-ZFYZTMLRSA-N |
| SMILES | CS[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)