Products 67633-91-4

CAS 67633-91-4 is the registry number for 1-Methoxy-1-oxohexane-2-sulfonic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-methoxy-1-oxohexane-2-sulfonic acid (CAS 67633-91-4) is a chemical compound with the molecular formula C7H14O5S and a molecular weight of 210.25 g/mol. IUPAC name: 1-methoxy-1-oxohexane-2-sulfonic acid. InChIKey: UBYPTUABMDKJNG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14O5S
Molecular weight210.25 g/mol
IUPAC name1-methoxy-1-oxohexane-2-sulfonic acid
InChIKeyUBYPTUABMDKJNG-UHFFFAOYSA-N
SMILESCCCCC(C(=O)OC)S(=O)(=O)O

Computed by PubChem (NCBI)