Products 30762-06-2
CAS 30762-06-2 appears in our catalog under these names: 4-(2-phenylethoxy)benzoic acid, 95%, 4–Phenethoxybenzoic acid, 4-Phenethoxybenzoic acid 95%, 4-Phenethoxybenzoic acid, 95%, 95%. Offered by: Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
4-(2-phenylethoxy)benzoic acid (CAS 30762-06-2) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 4-(2-phenylethoxy)benzoic acid. InChIKey: FRQLEOHJRISXFC-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 4-(2-phenylethoxy)benzoic acid |
| InChIKey | FRQLEOHJRISXFC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCOC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)