Products 3077523-87-3
CAS 3077523-87-3 is the registry number for [(3R,4R)-1-Boc-3-methyl-4-piperidyl]methanol, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (3R,4R)-4-(hydroxymethyl)-3-methylpiperidine-1-carboxylate (CAS 3077523-87-3) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl (3R,4R)-4-(hydroxymethyl)-3-methylpiperidine-1-carboxylate. InChIKey: FNURCZDNQROJJJ-UWVGGRQHSA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl (3R,4R)-4-(hydroxymethyl)-3-methylpiperidine-1-carboxylate |
| InChIKey | FNURCZDNQROJJJ-UWVGGRQHSA-N |
| SMILES | C[C@H]1CN(CC[C@H]1CO)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)