CAS 3077989-52-4 appears in our catalog under these names: 5-Bromo-4-iodo-1-methyl-1H-indazole, 95%, 95%, 5-Bromo-4-iodo-1-methyl-1H-indazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-4-iodo-1-methylindazole (CAS 3077989-52-4) is a chemical compound with the molecular formula C8H6BrIN2 and a molecular weight of 336.95 g/mol. IUPAC name: 5-bromo-4-iodo-1-methylindazole. InChIKey: QBHQDQXGLZGCHY-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIN2 |
|---|---|
| Molecular weight | 336.95 g/mol |
| IUPAC name | 5-bromo-4-iodo-1-methylindazole |
| InChIKey | QBHQDQXGLZGCHY-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=C(C=C2)Br)I |
Computed by PubChem (NCBI)