CAS 307929-32-4 appears in our catalog under these names: 2-(3-Chlorophenyl)-4,6-diphenyl-1,3,5-triazine, 98%, 98%, 2-(3-Chlorophenyl)-4,6-diphenyl-1,3,5-triazine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2-(3-chlorophenyl)-4,6-diphenyl-1,3,5-triazine (CAS 307929-32-4) is a chemical compound with the molecular formula C21H14ClN3 and a molecular weight of 343.8 g/mol. IUPAC name: 2-(3-chlorophenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: OVNPUJOZNPAVJQ-UHFFFAOYSA-N.
| Molecular formula | C21H14ClN3 |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | OVNPUJOZNPAVJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC(=CC=C3)Cl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)