CAS 77989-14-1 appears in our catalog under these names: 2–(2–Chlorophenyl)–4,6–diphenyl–1,3,5–triazine, 2-(2-chlorophenyl)-4,6-diphenyl-1,3,5-triazine, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g.
2-(2-chlorophenyl)-4,6-diphenyl-1,3,5-triazine (CAS 77989-14-1) is a chemical compound with the molecular formula C21H14ClN3 and a molecular weight of 343.8 g/mol. IUPAC name: 2-(2-chlorophenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: VNJGHLSQJTVFPH-UHFFFAOYSA-N.
| Molecular formula | C21H14ClN3 |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | VNJGHLSQJTVFPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=CC=C3Cl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)