Products 3079427-49-6
CAS 3079427-49-6 is the registry number for 1-(difluoromethyl)-2-oxabicyclo[2.2.2]octane-4-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-(difluoromethyl)-2-oxabicyclo[2.2.2]octane-4-carboxylic acid (CAS 3079427-49-6) is a chemical compound with the molecular formula C9H12F2O3 and a molecular weight of 206.19 g/mol. IUPAC name: 1-(difluoromethyl)-2-oxabicyclo[2.2.2]octane-4-carboxylic acid. InChIKey: AOKLUPUDSSFFNK-UHFFFAOYSA-N.
| Molecular formula | C9H12F2O3 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 1-(difluoromethyl)-2-oxabicyclo[2.2.2]octane-4-carboxylic acid |
| InChIKey | AOKLUPUDSSFFNK-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(CO2)C(=O)O)C(F)F |
Computed by PubChem (NCBI)