Products 3079775-26-8
CAS 3079775-26-8 is the registry number for N-nitroso N-desmethyl rivastigmine solu. Offered by: Sigma-Aldrich. Available pack sizes: 1ML.
[3-[(1S)-1-[methyl(nitroso)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate (CAS 3079775-26-8) is a chemical compound with the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. IUPAC name: [3-[(1S)-1-[methyl(nitroso)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate. InChIKey: WHKHPRBCDYNPQG-JTQLQIEISA-N.
| Molecular formula | C13H19N3O3 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | [3-[(1S)-1-[methyl(nitroso)amino]ethyl]phenyl] N-ethyl-N-methylcarbamate |
| InChIKey | WHKHPRBCDYNPQG-JTQLQIEISA-N |
| SMILES | CCN(C)C(=O)OC1=CC=CC(=C1)[C@H](C)N(C)N=O |
Computed by PubChem (NCBI)