Products 30817-90-4
CAS 30817-90-4 is the registry number for 4,4'-(Cyclohexane-1,1-diyl)bis(2-aminophenol), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-4-[1-(3-amino-4-hydroxyphenyl)cyclohexyl]phenol (CAS 30817-90-4) is a chemical compound with the molecular formula C18H22N2O2 and a molecular weight of 298.4 g/mol. IUPAC name: 2-amino-4-[1-(3-amino-4-hydroxyphenyl)cyclohexyl]phenol. InChIKey: BOVSSHUURZCDRR-UHFFFAOYSA-N.
| Molecular formula | C18H22N2O2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 2-amino-4-[1-(3-amino-4-hydroxyphenyl)cyclohexyl]phenol |
| InChIKey | BOVSSHUURZCDRR-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC(=C(C=C2)O)N)C3=CC(=C(C=C3)O)N |
Computed by PubChem (NCBI)