Products 308298-51-3
CAS 308298-51-3 is the registry number for FGFR1 inhibitor-17. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-(4-chlorophenoxy)-5-methyl-1H-pyrazol-3-yl]benzene-1,3-diol (CAS 308298-51-3) is a chemical compound with the molecular formula C16H13ClN2O3 and a molecular weight of 316.74 g/mol. IUPAC name: 4-[4-(4-chlorophenoxy)-5-methyl-1H-pyrazol-3-yl]benzene-1,3-diol. InChIKey: RXNAWJOUYWUNJU-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O3 |
|---|---|
| Molecular weight | 316.74 g/mol |
| IUPAC name | 4-[4-(4-chlorophenoxy)-5-methyl-1H-pyrazol-3-yl]benzene-1,3-diol |
| InChIKey | RXNAWJOUYWUNJU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C2=C(C=C(C=C2)O)O)OC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)