CAS 881443-07-8 is the registry number for 6-(4-Chlorophenyl)-3-isopropylisoxazolo[5,4-b]pyridine-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(4-chlorophenyl)-3-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 881443-07-8) is a chemical compound with the molecular formula C16H13ClN2O3 and a molecular weight of 316.74 g/mol. IUPAC name: 6-(4-chlorophenyl)-3-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: BSYYXWCFTKJISD-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O3 |
|---|---|
| Molecular weight | 316.74 g/mol |
| IUPAC name | 6-(4-chlorophenyl)-3-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | BSYYXWCFTKJISD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NOC2=C1C(=CC(=N2)C3=CC=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)