CAS 30830-04-7 appears in our catalog under these names: 1,4-Dimethyl-3-phenyl-1h-pyrazol-5-amine, 95%, 1,4-dimethyl-3-phenyl-1H-pyrazol-5-amine hydrochloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
1,4-dimethyl-3-phenylpyrazol-5-amine (CAS 30830-04-7) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 1,4-dimethyl-3-phenylpyrazol-5-amine. InChIKey: BZJUAPFLXLAQDN-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 1,4-dimethyl-3-phenylpyrazol-5-amine |
| InChIKey | BZJUAPFLXLAQDN-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C2=CC=CC=C2)C)N |
Computed by PubChem (NCBI)