Products 30877-30-6

CAS 30877-30-6 appears in our catalog under these names: 5,6-Dimethyl-1h-indole, 95%, 5,6–Dimethyl–1H–indole, 5,6-Dimethyl-1H-indole, 5,6-Dimethyl-1H-indole 95%, 5,6-Dimethyl-1H-indole, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 20mg, 2,5g, 1g, 5g.

Structural formula: {0} (CAS {1})

5,6-dimethyl-1H-indole (CAS 30877-30-6) is a chemical compound with the molecular formula C10H11N and a molecular weight of 145.20 g/mol. IUPAC name: 5,6-dimethyl-1H-indole. InChIKey: VQSHETACGYAGAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11N
Molecular weight145.20 g/mol
IUPAC name5,6-dimethyl-1H-indole
InChIKeyVQSHETACGYAGAQ-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1C)NC=C2

Computed by PubChem (NCBI)