CAS 30889-48-6 is the registry number for 3-Phenylnaphthalen-2-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-phenylnaphthalen-2-ol (CAS 30889-48-6) is a chemical compound with the molecular formula C16H12O and a molecular weight of 220.26 g/mol. IUPAC name: 3-phenylnaphthalen-2-ol. InChIKey: MWQOAVCLNQKMSH-UHFFFAOYSA-N.
| Molecular formula | C16H12O |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 3-phenylnaphthalen-2-ol |
| InChIKey | MWQOAVCLNQKMSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3C=C2O |
Computed by PubChem (NCBI)