Products 3090841-12-3
CAS 3090841-12-3 is the registry number for 3’-Fluoro-5’-(trifluoromethyl)-2H-[1,2’-bipyridin]-2-one, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one (CAS 3090841-12-3) is a chemical compound with the molecular formula C11H6F4N2O and a molecular weight of 258.17 g/mol. IUPAC name: 1-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one. InChIKey: HOHAPOJPLZDECB-UHFFFAOYSA-N.
| Molecular formula | C11H6F4N2O |
|---|---|
| Molecular weight | 258.17 g/mol |
| IUPAC name | 1-[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one |
| InChIKey | HOHAPOJPLZDECB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1)C2=C(C=C(C=N2)C(F)(F)F)F |
Computed by PubChem (NCBI)