Products 30915-81-2
CAS 30915-81-2 is the registry number for 1,4:3,6-Dianhydro-2,5-di-O-ethyl-D-glucitol. Offered by: Biosynth. Available pack sizes: 1g.
(3S,3aR,6R,6aR)-3,6-diethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (CAS 30915-81-2) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: (3S,3aR,6R,6aR)-3,6-diethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan. InChIKey: AWODWWZOMLJAAS-UTINFBMNSA-N.
| Molecular formula | C10H18O4 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (3S,3aR,6R,6aR)-3,6-diethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| InChIKey | AWODWWZOMLJAAS-UTINFBMNSA-N |
| SMILES | CCO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OCC |
Computed by PubChem (NCBI)