Products 3092659-89-4
CAS 3092659-89-4 is the registry number for N-Methyl-N-phenyl-5-(tetrahydro-2H-pyran-4-yl)-1H-indole-2-carboxamide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-methyl-5-(oxan-4-yl)-N-phenyl-1H-indole-2-carboxamide (CAS 3092659-89-4) is a chemical compound with the molecular formula C21H22N2O2 and a molecular weight of 334.4 g/mol. IUPAC name: N-methyl-5-(oxan-4-yl)-N-phenyl-1H-indole-2-carboxamide. InChIKey: IQBQVUCIRKBBAH-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O2 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | N-methyl-5-(oxan-4-yl)-N-phenyl-1H-indole-2-carboxamide |
| InChIKey | IQBQVUCIRKBBAH-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)C(=O)C2=CC3=C(N2)C=CC(=C3)C4CCOCC4 |
Computed by PubChem (NCBI)