CAS 309275-47-6 appears in our catalog under these names: 5-Chloro-4,6-dimethyl-2-oxo-1,2-dihydro-3-pyridinecarboxylic acid, 95%, 5-Chloro-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-chloro-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid (CAS 309275-47-6) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 5-chloro-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: ILAMGKVVUJDDSF-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 5-chloro-4,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | ILAMGKVVUJDDSF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=C1Cl)C)C(=O)O |
Computed by PubChem (NCBI)