Products 3093814-66-2
CAS 3093814-66-2 is the registry number for rel-[(3aR,7aR)-1-Boc-octahydro-1H-indol-3a-yl]methanamine, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (3aR,7aR)-3a-(aminomethyl)-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (CAS 3093814-66-2) is a chemical compound with the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. IUPAC name: tert-butyl (3aR,7aR)-3a-(aminomethyl)-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate. InChIKey: APOAUNNOAJYODG-BXUZGUMPSA-N.
| Molecular formula | C14H26N2O2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | tert-butyl (3aR,7aR)-3a-(aminomethyl)-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| InChIKey | APOAUNNOAJYODG-BXUZGUMPSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@]2([C@H]1CCCC2)CN |
Computed by PubChem (NCBI)