Products 3095661-21-2
CAS 3095661-21-2 is the registry number for ZJS178. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl (Z)-3-amino-2-cyano-3-[4-[ethyl(methyl)amino]phenyl]prop-2-enoate (CAS 3095661-21-2) is a chemical compound with the molecular formula C15H19N3O2 and a molecular weight of 273.33 g/mol. IUPAC name: ethyl (Z)-3-amino-2-cyano-3-[4-[ethyl(methyl)amino]phenyl]prop-2-enoate. InChIKey: LNAZEQHZUUSJMX-YPKPFQOOSA-N.
| Molecular formula | C15H19N3O2 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | ethyl (Z)-3-amino-2-cyano-3-[4-[ethyl(methyl)amino]phenyl]prop-2-enoate |
| InChIKey | LNAZEQHZUUSJMX-YPKPFQOOSA-N |
| SMILES | CCN(C)C1=CC=C(C=C1)/C(=C(\C#N)/C(=O)OCC)/N |
Computed by PubChem (NCBI)