CAS 309915-46-6 appears in our catalog under these names: (2R,5S)–tert–Butyl 2,5–dimethylpiperazine–1–carboxylate, (2R,5S)-tert-Butyl 2,5-dimethylpiperazine-1-carboxylate, 95%, 95%, (2R,5S)-tert-Butyl 2,5-dimethylpiperazine-1-carboxylate, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 250mg, 1g, 500g, 25g, 100g.
Tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate (CAS 309915-46-6) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate. InChIKey: PGZCVLUQTJRRAA-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate |
| InChIKey | PGZCVLUQTJRRAA-DTWKUNHWSA-N |
| SMILES | C[C@@H]1CN[C@H](CN1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)