Products 30994-23-1
CAS 30994-23-1 appears in our catalog under these names: Dimethyl Succinate-d4, Dimethyl Succinate-d4, 98 atom % D, min 98% Chemical Purity, dimethyl succinate–2，2，3，3–D4, Dimethyl succinate-d4, 99.45%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 1g, 500mg, 100 mg, 25 mg, 50 mg.
Dimethyl 2,2,3,3-tetradeuteriobutanedioate (CAS 30994-23-1) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 150.17 g/mol. IUPAC name: dimethyl 2,2,3,3-tetradeuteriobutanedioate. InChIKey: MUXOBHXGJLMRAB-KHORGVISSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 150.17 g/mol |
| IUPAC name | dimethyl 2,2,3,3-tetradeuteriobutanedioate |
| InChIKey | MUXOBHXGJLMRAB-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C(=O)OC)C([2H])([2H])C(=O)OC |
Computed by PubChem (NCBI)