Products 31009-06-0

CAS 31009-06-0 is the registry number for 6-Fluoro-2-(trifluoromethyl)quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

6-fluoro-2-(trifluoromethyl)quinoline-4-carboxylic acid (CAS 31009-06-0) is a chemical compound with the molecular formula C11H5F4NO2 and a molecular weight of 259.16 g/mol. IUPAC name: 6-fluoro-2-(trifluoromethyl)quinoline-4-carboxylic acid. InChIKey: RVQQIQCSUJBIMH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H5F4NO2
Molecular weight259.16 g/mol
IUPAC name6-fluoro-2-(trifluoromethyl)quinoline-4-carboxylic acid
InChIKeyRVQQIQCSUJBIMH-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1F)C(=CC(=N2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)