CAS 927896-24-0 is the registry number for 3-(2-Fluoro-4-(trifluoromethyl)phenyl)-1h-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
3-[2-fluoro-4-(trifluoromethyl)phenyl]pyrrole-2,5-dione (CAS 927896-24-0) is a chemical compound with the molecular formula C11H5F4NO2 and a molecular weight of 259.16 g/mol. IUPAC name: 3-[2-fluoro-4-(trifluoromethyl)phenyl]pyrrole-2,5-dione. InChIKey: UHZSBYCUAZPJBQ-UHFFFAOYSA-N.
| Molecular formula | C11H5F4NO2 |
|---|---|
| Molecular weight | 259.16 g/mol |
| IUPAC name | 3-[2-fluoro-4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| InChIKey | UHZSBYCUAZPJBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)C2=CC(=O)NC2=O |
Computed by PubChem (NCBI)