CAS 31010-94-3 appears in our catalog under these names: 2,2-Dimethyl-2,3-dihydrobenzofuran-5-amine, 97%, 2,2-Dimethyl-2,3-dihydro-1-benzofuran-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2-dimethyl-3H-1-benzofuran-5-amine (CAS 31010-94-3) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: 2,2-dimethyl-3H-1-benzofuran-5-amine. InChIKey: LWDIQKVNWBXIMP-UHFFFAOYSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | 2,2-dimethyl-3H-1-benzofuran-5-amine |
| InChIKey | LWDIQKVNWBXIMP-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C=CC(=C2)N)C |
Computed by PubChem (NCBI)