CAS 3108-23-4 appears in our catalog under these names: 4,4,4–Trifluoro–2–(4–fluorophenyl)–3–oxobutanenitrile, 4,4,4-Trifluoro-2-(4-fluorophenyl)-3-oxobutanenitrile, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 5g.
4,4,4-trifluoro-2-(4-fluorophenyl)-3-oxobutanenitrile (CAS 3108-23-4) is a chemical compound with the molecular formula C10H5F4NO and a molecular weight of 231.15 g/mol. IUPAC name: 4,4,4-trifluoro-2-(4-fluorophenyl)-3-oxobutanenitrile. InChIKey: RCAQVQYAKNWDSW-UHFFFAOYSA-N.
| Molecular formula | C10H5F4NO |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | 4,4,4-trifluoro-2-(4-fluorophenyl)-3-oxobutanenitrile |
| InChIKey | RCAQVQYAKNWDSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C#N)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)