CAS 70276-69-6 appears in our catalog under these names: 5-Fluoro-2-phenyl-4-(trifluoromethyl)oxazole, 95+%, 5-Fluoro-2-phenyl-4-(trifluoromethyl)-1,3-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-fluoro-2-phenyl-4-(trifluoromethyl)-1,3-oxazole (CAS 70276-69-6) is a chemical compound with the molecular formula C10H5F4NO and a molecular weight of 231.15 g/mol. IUPAC name: 5-fluoro-2-phenyl-4-(trifluoromethyl)-1,3-oxazole. InChIKey: PWMKGRHSCBQLQG-UHFFFAOYSA-N.
| Molecular formula | C10H5F4NO |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | 5-fluoro-2-phenyl-4-(trifluoromethyl)-1,3-oxazole |
| InChIKey | PWMKGRHSCBQLQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(O2)F)C(F)(F)F |
Computed by PubChem (NCBI)