CAS 3108-32-5 is the registry number for 1,1,1-Trifluoro-4-phenyl-3-buten-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-one (CAS 3108-32-5) is a chemical compound with the molecular formula C10H7F3O and a molecular weight of 200.16 g/mol. IUPAC name: (E)-1,1,1-trifluoro-4-phenylbut-3-en-2-one. InChIKey: ADEYYFREIBSWFP-VOTSOKGWSA-N.
| Molecular formula | C10H7F3O |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | (E)-1,1,1-trifluoro-4-phenylbut-3-en-2-one |
| InChIKey | ADEYYFREIBSWFP-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)C(F)(F)F |
Computed by PubChem (NCBI)