CAS 31137-74-3 appears in our catalog under these names: (2S,4R)-4-Methylglutamic Acid, SYM 2081/ 99.59% (existing batch purity), SYM 2081, SYM 2081 98%, (2S,4R)-2-Amino-4-methylpentanedioic acid, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(2S,4R)-2-azaniumyl-4-methylpentanedioate (CAS 31137-74-3) is a chemical compound with the molecular formula C6H10NO4- and a molecular weight of 160.15 g/mol. IUPAC name: (2S,4R)-2-azaniumyl-4-methylpentanedioate. InChIKey: KRKRAOXTGDJWNI-DMTCNVIQSA-M.
| Molecular formula | C6H10NO4- |
|---|---|
| Molecular weight | 160.15 g/mol |
| IUPAC name | (2S,4R)-2-azaniumyl-4-methylpentanedioate |
| InChIKey | KRKRAOXTGDJWNI-DMTCNVIQSA-M |
| SMILES | C[C@H](C[C@@H](C(=O)[O-])[NH3+])C(=O)[O-] |
Computed by PubChem (NCBI)