Products 6141-27-1
CAS 6141-27-1 appears in our catalog under these names: (2S,4S)-2-Amino-4-methylpentanedioic acid, 97%, (2S,4S)-4-Methylglutamic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 5mg.
(2S,4S)-2-amino-4-methylpentanedioic acid (CAS 6141-27-1) is a chemical compound with the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. IUPAC name: (2S,4S)-2-amino-4-methylpentanedioic acid. InChIKey: KRKRAOXTGDJWNI-IMJSIDKUSA-N.
| Molecular formula | C6H11NO4 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | (2S,4S)-2-amino-4-methylpentanedioic acid |
| InChIKey | KRKRAOXTGDJWNI-IMJSIDKUSA-N |
| SMILES | C[C@@H](C[C@@H](C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2S,4S)-2-amino-4-methylpentanedioic acid, (4S)-4-Methyl-L-glutamic Acid, 2S,4S-4-Methylglutamic acid, 4-Methyl-DL-glutamic acid, threo-, 4-Methyl-L-glutamic acid, (4S)-, DL-Glutamic acid, 4-methyl-, threo-, L-Glutamic acid, 4-methyl-, (4S)-, D-Glutamic acid, 4-methyl-, (4R)-rel-, starbld0018205, NCIStruc1_000060