CAS 31167-04-1 appears in our catalog under these names: (2,4-Dimethyl-3-nitro-phenyl) Amine, 2,4-Dimethyl-3-nitroaniline, 97%, 97%, 2,4-Dimethyl-3-nitroaniline, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
2,4-dimethyl-3-nitroaniline (CAS 31167-04-1) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2,4-dimethyl-3-nitroaniline. InChIKey: MCRYBELDVGNCFW-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 2,4-dimethyl-3-nitroaniline |
| InChIKey | MCRYBELDVGNCFW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)N)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)