Products 3116821-58-7
CAS 3116821-58-7 is the registry number for ((3aS,7aS)-7-Bromo-2,2-dimethyl-3a,7a-dihydrobenzo[d][1,3]dioxol-4-yl)methanol. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(3aS,7aS)-7-bromo-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]methanol (CAS 3116821-58-7) is a chemical compound with the molecular formula C10H13BrO3 and a molecular weight of 261.11 g/mol. IUPAC name: [(3aS,7aS)-7-bromo-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]methanol. InChIKey: UPGUEWIOZVOHCB-DTWKUNHWSA-N.
| Molecular formula | C10H13BrO3 |
|---|---|
| Molecular weight | 261.11 g/mol |
| IUPAC name | [(3aS,7aS)-7-bromo-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]methanol |
| InChIKey | UPGUEWIOZVOHCB-DTWKUNHWSA-N |
| SMILES | CC1(O[C@@H]2[C@H](O1)C(=CC=C2CO)Br)C |
Computed by PubChem (NCBI)