Products 3121624-97-0
CAS 3121624-97-0 is the registry number for (3-(Benzyloxy)-2-bromo-4,6-difluorophenyl)methanol, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2-bromo-4,6-difluoro-3-phenylmethoxyphenyl)methanol (CAS 3121624-97-0) is a chemical compound with the molecular formula C14H11BrF2O2 and a molecular weight of 329.14 g/mol. IUPAC name: (2-bromo-4,6-difluoro-3-phenylmethoxyphenyl)methanol. InChIKey: LYIFLJKJABYEQB-UHFFFAOYSA-N.
| Molecular formula | C14H11BrF2O2 |
|---|---|
| Molecular weight | 329.14 g/mol |
| IUPAC name | (2-bromo-4,6-difluoro-3-phenylmethoxyphenyl)methanol |
| InChIKey | LYIFLJKJABYEQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C(=C2Br)CO)F)F |
Computed by PubChem (NCBI)