CAS 312271-03-7 appears in our catalog under these names: M2I-1, 95%, M2I-1, M2I–1, M2I-1 98%, M2I-1, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 1mg, 250mg.
5-[[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 312271-03-7) is a chemical compound with the molecular formula C19H24N4O4S and a molecular weight of 404.5 g/mol. IUPAC name: 5-[[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: BWEKPQUKWLNUKX-UHFFFAOYSA-N.
| Molecular formula | C19H24N4O4S |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | 5-[[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | BWEKPQUKWLNUKX-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(C)C)C1=C(C=C(C=C1)C=C2C(=O)NC(=S)NC2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)