CAS 89131-11-3 appears in our catalog under these names: Dabsyl-l-valine, 95%, Dabsyl-L-valine, >95.0%(HPLC)(qNMR). Offered by: Combi-blocks, TCI. Available pack sizes: 100mg.
(2S)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-3-methylbutanoic acid (CAS 89131-11-3) is a chemical compound with the molecular formula C19H24N4O4S and a molecular weight of 404.5 g/mol. IUPAC name: (2S)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-3-methylbutanoic acid. InChIKey: AJSKPBGSGLIRQK-SFHVURJKSA-N.
| Molecular formula | C19H24N4O4S |
|---|---|
| Molecular weight | 404.5 g/mol |
| IUPAC name | (2S)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-3-methylbutanoic acid |
| InChIKey | AJSKPBGSGLIRQK-SFHVURJKSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)