CAS 312277-89-7 is the registry number for 5-(3-thienylmethylene)-2-thioxoimidazolidin-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
(5E)-2-sulfanylidene-5-(thiophen-3-ylmethylidene)imidazolidin-4-one (CAS 312277-89-7) is a chemical compound with the molecular formula C8H6N2OS2 and a molecular weight of 210.3 g/mol. IUPAC name: (5E)-2-sulfanylidene-5-(thiophen-3-ylmethylidene)imidazolidin-4-one. InChIKey: BOKKBYFFNHWOJO-ZZXKWVIFSA-N.
| Molecular formula | C8H6N2OS2 |
|---|---|
| Molecular weight | 210.3 g/mol |
| IUPAC name | (5E)-2-sulfanylidene-5-(thiophen-3-ylmethylidene)imidazolidin-4-one |
| InChIKey | BOKKBYFFNHWOJO-ZZXKWVIFSA-N |
| SMILES | C1=CSC=C1/C=C/2\C(=O)NC(=S)N2 |
Computed by PubChem (NCBI)