CAS 312303-93-8 is the registry number for (3-Methanesulfonylphenyl)hydrazine. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 1g.
(3-methylsulfonylphenyl)hydrazine (CAS 312303-93-8) is a chemical compound with the molecular formula C7H10N2O2S and a molecular weight of 186.23 g/mol. IUPAC name: (3-methylsulfonylphenyl)hydrazine. InChIKey: SZPJJHUFWHTSON-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O2S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | (3-methylsulfonylphenyl)hydrazine |
| InChIKey | SZPJJHUFWHTSON-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)NN |
Computed by PubChem (NCBI)