CAS 31241-19-7 appears in our catalog under these names: 2,3,3-Trimethyl-5-methoxy-3h-indole, 95%, 5–Methoxy–2,3,3–trimethyl–3H–indole, 2,3,3-Trimethyl 5-methoxy indolenine, 5-Methoxy-2,3,3-trimethyl-3H-indole 95%, 5-Methoxy-2,3,3-trimethyl-3H-indole, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 50mg, 500mg, 1000mg, 10g.
5-methoxy-2,3,3-trimethylindole (CAS 31241-19-7) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 5-methoxy-2,3,3-trimethylindole. InChIKey: UOGHZHPESMATDD-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 5-methoxy-2,3,3-trimethylindole |
| InChIKey | UOGHZHPESMATDD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)C)C=C(C=C2)OC |
Computed by PubChem (NCBI)