CAS 31255-58-0 is the registry number for Loratadine Impurity 49. Offered by: Chemat Brand. Available pack sizes: on request.
5-[2-(3-chlorophenyl)ethyl]pyridine-2-carbonitrile (CAS 31255-58-0) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 5-[2-(3-chlorophenyl)ethyl]pyridine-2-carbonitrile. InChIKey: AZXXVVJPDYUBOX-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 5-[2-(3-chlorophenyl)ethyl]pyridine-2-carbonitrile |
| InChIKey | AZXXVVJPDYUBOX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CCC2=CN=C(C=C2)C#N |
Computed by PubChem (NCBI)