CAS 312623-85-1 appears in our catalog under these names: L–Alanine–13C2,15N, L-ALANINE-13C3-15N, 98+ ATOM % 13C,, L-Alanine-13C2,15N, 99%, 99%, L-Alanine-13C2,15N, 99.0%. Offered by: GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 100MG, 1mg, 1 mg, 5 mg, 10 mg.
(2S)-2-(15N)azanyl(1,2,3-13C3)propanoic acid (CAS 312623-85-1) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 93.065 g/mol. IUPAC name: (2S)-2-(15N)azanyl(1,2,3-13C3)propanoic acid. InChIKey: QNAYBMKLOCPYGJ-UVYXLFMMSA-N.
| Molecular formula | C3H7NO2 |
|---|---|
| Molecular weight | 93.065 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl(1,2,3-13C3)propanoic acid |
| InChIKey | QNAYBMKLOCPYGJ-UVYXLFMMSA-N |
| SMILES | [13CH3][13C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)