CAS 312920-69-7 is the registry number for 3-Deoxygalanthamine. Offered by: TRC. Available pack sizes: 25mg.
(1S,12S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene (CAS 312920-69-7) is a chemical compound with the molecular formula C17H21NO2 and a molecular weight of 271.35 g/mol. IUPAC name: (1S,12S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene. InChIKey: UKUVCVJKXPDUPB-YOEHRIQHSA-N.
| Molecular formula | C17H21NO2 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | (1S,12S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene |
| InChIKey | UKUVCVJKXPDUPB-YOEHRIQHSA-N |
| SMILES | CN1CC[C@@]23C=CCC[C@@H]2OC4=C(C=CC(=C34)C1)OC |
Computed by PubChem (NCBI)