Products 31298-54-1
CAS 31298-54-1 is the registry number for Panepoxydone. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
(1S,5R,6S)-5-hydroxy-3-[(1S)-1-hydroxy-3-methylbut-2-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one (CAS 31298-54-1) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: (1S,5R,6S)-5-hydroxy-3-[(1S)-1-hydroxy-3-methylbut-2-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one. InChIKey: MBXKEYXHJAZKBP-GISOBZBCSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | (1S,5R,6S)-5-hydroxy-3-[(1S)-1-hydroxy-3-methylbut-2-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| InChIKey | MBXKEYXHJAZKBP-GISOBZBCSA-N |
| SMILES | CC(=C[C@@H](C1=C[C@H]([C@H]2[C@@H](C1=O)O2)O)O)C |
Computed by PubChem (NCBI)