CAS 313222-85-4 is the registry number for Sodium 2–phenoxyacetate hydrate. Offered by: GLPBio. Available pack sizes: 25g, 5g.
Sodium;2-phenoxyacetate;hydrate (CAS 313222-85-4) is a chemical compound with the molecular formula C8H9NaO4 and a molecular weight of 192.14 g/mol. IUPAC name: sodium;2-phenoxyacetate;hydrate. InChIKey: MEQSSBKFRRPKBI-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO4 |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | sodium;2-phenoxyacetate;hydrate |
| InChIKey | MEQSSBKFRRPKBI-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)OCC(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)