CAS 57675-45-3 is the registry number for cis-Delta4-Tetrahydrophthalic Acid Sodium Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
Sodium 6-carboxycyclohex-3-ene-1-carboxylate (CAS 57675-45-3) is a chemical compound with the molecular formula C8H9NaO4 and a molecular weight of 192.14 g/mol. IUPAC name: sodium 6-carboxycyclohex-3-ene-1-carboxylate. InChIKey: DSQJWWZJQSSRHV-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO4 |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | sodium 6-carboxycyclohex-3-ene-1-carboxylate |
| InChIKey | DSQJWWZJQSSRHV-UHFFFAOYSA-M |
| SMILES | C1C=CCC(C1C(=O)O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)