CAS 313233-82-8 is the registry number for 4-Chloro-3-nitro-N-(thiazol-2-yl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3-nitro-N-(1,3-thiazol-2-yl)benzamide (CAS 313233-82-8) is a chemical compound with the molecular formula C10H6ClN3O3S and a molecular weight of 283.69 g/mol. IUPAC name: 4-chloro-3-nitro-N-(1,3-thiazol-2-yl)benzamide. InChIKey: WGONSXNFGGQFQC-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3O3S |
|---|---|
| Molecular weight | 283.69 g/mol |
| IUPAC name | 4-chloro-3-nitro-N-(1,3-thiazol-2-yl)benzamide |
| InChIKey | WGONSXNFGGQFQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NC2=NC=CS2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)