CAS 313371-86-7 is the registry number for (2-chloro-5-nitrophenyl)-N-(2,5-thiazolyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-chloro-5-nitro-N-(1,3-thiazol-2-yl)benzamide (CAS 313371-86-7) is a chemical compound with the molecular formula C10H6ClN3O3S and a molecular weight of 283.69 g/mol. IUPAC name: 2-chloro-5-nitro-N-(1,3-thiazol-2-yl)benzamide. InChIKey: UVCDTKPPKLVNLO-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3O3S |
|---|---|
| Molecular weight | 283.69 g/mol |
| IUPAC name | 2-chloro-5-nitro-N-(1,3-thiazol-2-yl)benzamide |
| InChIKey | UVCDTKPPKLVNLO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)NC2=NC=CS2)Cl |
Computed by PubChem (NCBI)